
4584-49-0
| Name | 2-Dimethylaminoisopropyl chloride hydrochloride |
| CAS | 4584-49-0 |
| EINECS(EC#) | 224-971-7 |
| Molecular Formula | C5H13Cl2N |
| MDL Number | MFCD00012534 |
| Molecular Weight | 158.07 |
| MOL File | 4584-49-0.mol |
Chemical Properties
| Appearance | Colourless to pale beige crystalline powder |
| Melting point | 187-190 °C(lit.) |
| bulk density | 350kg/m3 |
| storage temp. | Store at RT. |
| solubility | 2000g/l |
| form | Crystalline Powder |
| color | White to light cream |
| PH | 5-6 (500g/l, H2O, 20℃) |
| Water Solubility | 2000 g/L (20 º C) |
| Sensitive | Hygroscopic |
| Usage | 2-Chloro-N,N-dimethylpropylamine hydrochloride (DMIC) is used as intermediate for the syntheses of pharmaceuticals (e.g. isothipendyl, methadone and promethazine) Product Data Sheet |
| BRN | 3670215 |
| InChI | InChI=1S/C5H12ClN.ClH/c1-5(6)4-7(2)3;/h5H,4H2,1-3H3;1H |
| InChIKey | OCWGRWAYARCRTQ-UHFFFAOYSA-N |
| SMILES | C(Cl)(C)CN(C)C.Cl |
| CAS DataBase Reference | 4584-49-0(CAS DataBase Reference) |
| EPA Substance Registry System | 4584-49-0(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | TY1225000 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29211980 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

